C12H18ClN3O2 — CID 113293068
2-[4-(chloromethyl)piperidin-1-yl]-4,6-dimethoxypyrimidine (PubChem CID 113293068) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-[4-(chloromethyl)piperidin-1-yl]-4,6-dimethoxypyrimidine.
| Compound Name | 2-[4-(chloromethyl)piperidin-1-yl]-4,6-dimethoxypyrimidine |
|---|---|
| PubChem CID | 113293068 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-[4-(chloromethyl)piperidin-1-yl]-4,6-dimethoxypyrimidine |
| SMILES | COc1cc(OC)nc(N2CCC(CCl)CC2)n1 |
| InChI | InChI=1S/C12H18ClN3O2/c1-17-10-7-11(18-2)15-12(14-10)16-5-3-9(8-13)4-6-16/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | VCOFFXSCBYGVIU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|