C14H24N4O3 — CID 115355389
3-[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-4-yl]oxypropan-1-amine (PubChem CID 115355389) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-4-yl]oxypropan-1-amine.
| Compound Name | 3-[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-4-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 115355389 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 3-[1-(4,6-dimethoxypyrimidin-2-yl)piperidin-4-yl]oxypropan-1-amine |
| SMILES | COc1cc(OC)nc(N2CCC(OCCCN)CC2)n1 |
| InChI | InChI=1S/C14H24N4O3/c1-19-12-10-13(20-2)17-14(16-12)18-7-4-11(5-8-18)21-9-3-6-15/h10-11H,3-9,15H2,1-2H3 |
| InChIKey | JHJJQUCKMZGUMT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|