C12H19N3O3 — CID 112627918
1-[1-(4,6-dimethoxypyrimidin-2-yl)pyrrolidin-3-yl]ethanol (PubChem CID 112627918) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-[1-(4,6-dimethoxypyrimidin-2-yl)pyrrolidin-3-yl]ethanol.
| Compound Name | 1-[1-(4,6-dimethoxypyrimidin-2-yl)pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 112627918 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 1-[1-(4,6-dimethoxypyrimidin-2-yl)pyrrolidin-3-yl]ethanol |
| SMILES | COc1cc(OC)nc(N2CCC(C(C)O)C2)n1 |
| InChI | InChI=1S/C12H19N3O3/c1-8(16)9-4-5-15(7-9)12-13-10(17-2)6-11(14-12)18-3/h6,8-9,16H,4-5,7H2,1-3H3 |
| InChIKey | ACUDYXXWFFUOPS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |