C12H20N4O3 — CID 115355411
1-[4-(4,6-dimethoxypyrimidin-2-yl)morpholin-2-yl]ethanamine (PubChem CID 115355411) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-[4-(4,6-dimethoxypyrimidin-2-yl)morpholin-2-yl]ethanamine.
| Compound Name | 1-[4-(4,6-dimethoxypyrimidin-2-yl)morpholin-2-yl]ethanamine |
|---|---|
| PubChem CID | 115355411 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-[4-(4,6-dimethoxypyrimidin-2-yl)morpholin-2-yl]ethanamine |
| SMILES | COc1cc(OC)nc(N2CCOC(C(C)N)C2)n1 |
| InChI | InChI=1S/C12H20N4O3/c1-8(13)9-7-16(4-5-19-9)12-14-10(17-2)6-11(15-12)18-3/h6,8-9H,4-5,7,13H2,1-3H3 |
| InChIKey | BQZPRJPCHAAONL-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |