C18H23N7O2 — CID 118774271
[6-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]pyrazin-2-yl]-piperidin-1-ylmethanone (PubChem CID 118774271) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is [6-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]pyrazin-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [6-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]pyrazin-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 118774271 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [6-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]pyrazin-2-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cncc(N2CC[C@H]3[C@H](C2)OCc2cnnn23)n1)N1CCCCC1 |
| InChI | InChI=1S/C18H23N7O2/c26-18(23-5-2-1-3-6-23)14-9-19-10-17(21-14)24-7-4-15-16(11-24)27-12-13-8-20-22-25(13)15/h8-10,15-16H,1-7,11-12H2/t15-,16-/m0/s1 |
| InChIKey | BLGKBLWGWMLHMF-HOTGVXAUSA-N |
| XLogP | 1.04 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |