C16H15N5O2S2 — CID 118789702
[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]-(2-thiophen-2-yl-1,3-thiazol-4-yl)methanone (PubChem CID 118789702) has the molecular formula C16H15N5O2S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is [(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]-(2-thiophen-2-yl-1,3-thiazol-4-yl)methanone.
| Compound Name | [(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]-(2-thiophen-2-yl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 118789702 |
| Molecular Formula | C16H15N5O2S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | [(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]-(2-thiophen-2-yl-1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1csc(-c2cccs2)n1)N1CC[C@H]2[C@H](C1)OCc1cnnn12 |
| InChI | InChI=1S/C16H15N5O2S2/c22-16(11-9-25-15(18-11)14-2-1-5-24-14)20-4-3-12-13(7-20)23-8-10-6-17-19-21(10)12/h1-2,5-6,9,12-13H,3-4,7-8H2/t12-,13-/m0/s1 |
| InChIKey | BZZSRGPEWRWURT-STQMWFEESA-N |
| XLogP | 2.45 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |