C16H15F3N4O2 — CID 118772108
[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 118772108) has the molecular formula C16H15F3N4O2 and a molecular weight of 352.32 g/mol. Its IUPAC name is [(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 118772108 |
| Molecular Formula | C16H15F3N4O2 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N1CC[C@H]2[C@H](C1)OCc1cnnn12 |
| InChI | InChI=1S/C16H15F3N4O2/c17-16(18,19)11-3-1-2-10(6-11)15(24)22-5-4-13-14(8-22)25-9-12-7-20-21-23(12)13/h1-3,6-7,13-14H,4-5,8-9H2/t13-,14-/m0/s1 |
| InChIKey | BCGPOBCVJCOFSG-KBPBESRZSA-N |
| XLogP | 2.28 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |