C15H23N5O2 — CID 118794652
(1S,9S)-N-cyclohexyl-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene-11-carboxamide (PubChem CID 118794652) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (1S,9S)-N-cyclohexyl-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene-11-carboxamide.
| Compound Name | (1S,9S)-N-cyclohexyl-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene-11-carboxamide |
|---|---|
| PubChem CID | 118794652 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (1S,9S)-N-cyclohexyl-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene-11-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CC[C@H]2[C@H](C1)OCc1cnnn12 |
| InChI | InChI=1S/C15H23N5O2/c21-15(17-11-4-2-1-3-5-11)19-7-6-13-14(9-19)22-10-12-8-16-18-20(12)13/h8,11,13-14H,1-7,9-10H2,(H,17,21)/t13-,14-/m0/s1 |
| InChIKey | AZPNFLCNLZBUQV-KBPBESRZSA-N |
| XLogP | 1.47 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |