C19H20N4O3S — CID 118794992
1-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]-3-(5-thiophen-2-ylfuran-2-yl)propan-1-one (PubChem CID 118794992) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]-3-(5-thiophen-2-ylfuran-2-yl)propan-1-one.
| Compound Name | 1-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]-3-(5-thiophen-2-ylfuran-2-yl)propan-1-one |
|---|---|
| PubChem CID | 118794992 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[(1S,9S)-8-oxa-2,3,4,12-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-12-yl]-3-(5-thiophen-2-ylfuran-2-yl)propan-1-one |
| SMILES | O=C(CCc1ccc(-c2cccs2)o1)N1CC[C@@H]2OCc3cnnn3[C@H]2C1 |
| InChI | InChI=1S/C19H20N4O3S/c24-19(6-4-14-3-5-17(26-14)18-2-1-9-27-18)22-8-7-16-15(11-22)23-13(12-25-16)10-20-21-23/h1-3,5,9-10,15-16H,4,6-8,11-12H2/t15-,16-/m0/s1 |
| InChIKey | UQIMIRVOAKPTTL-HOTGVXAUSA-N |
| XLogP | 2.90 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |