C16H16N6O2 — CID 118783213
(1S,9S)-11-(3-phenyl-1,2,4-oxadiazol-5-yl)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene (PubChem CID 118783213) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is (1S,9S)-11-(3-phenyl-1,2,4-oxadiazol-5-yl)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene.
| Compound Name | (1S,9S)-11-(3-phenyl-1,2,4-oxadiazol-5-yl)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
|---|---|
| PubChem CID | 118783213 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (1S,9S)-11-(3-phenyl-1,2,4-oxadiazol-5-yl)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-diene |
| SMILES | c1ccc(-c2noc(N3CC[C@H]4[C@H](C3)OCc3cnnn34)n2)cc1 |
| InChI | InChI=1S/C16H16N6O2/c1-2-4-11(5-3-1)15-18-16(24-19-15)21-7-6-13-14(9-21)23-10-12-8-17-20-22(12)13/h1-5,8,13-14H,6-7,9-10H2/t13-,14-/m0/s1 |
| InChIKey | FPYAQKUGPOXKJP-KBPBESRZSA-N |
| XLogP | 1.68 |
| TPSA | 82.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |