C18H22N4O2S — CID 118767587
3-benzylsulfanyl-1-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]propan-1-one (PubChem CID 118767587) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]propan-1-one.
| Compound Name | 3-benzylsulfanyl-1-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]propan-1-one |
|---|---|
| PubChem CID | 118767587 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 3-benzylsulfanyl-1-[(1S,9S)-8-oxa-2,3,4,11-tetrazatricyclo[7.4.0.02,6]trideca-3,5-dien-11-yl]propan-1-one |
| SMILES | O=C(CCSCc1ccccc1)N1CC[C@H]2[C@H](C1)OCc1cnnn12 |
| InChI | InChI=1S/C18H22N4O2S/c23-18(7-9-25-13-14-4-2-1-3-5-14)21-8-6-16-17(11-21)24-12-15-10-19-20-22(15)16/h1-5,10,16-17H,6-9,11-13H2/t16-,17-/m0/s1 |
| InChIKey | KBFPJPASQGGUAW-IRXDYDNUSA-N |
| XLogP | 2.27 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|