C13H18N2O4S2 — CID 125174451
[(3R)-1-[2-(5-acetylthiophen-3-yl)acetyl]pyrrolidin-3-yl]methanesulfonamide (PubChem CID 125174451) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is [(3R)-1-[2-(5-acetylthiophen-3-yl)acetyl]pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [(3R)-1-[2-(5-acetylthiophen-3-yl)acetyl]pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 125174451 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | [(3R)-1-[2-(5-acetylthiophen-3-yl)acetyl]pyrrolidin-3-yl]methanesulfonamide |
| SMILES | CC(=O)c1cc(CC(=O)N2CC[C@@H](CS(N)(=O)=O)C2)cs1 |
| InChI | InChI=1S/C13H18N2O4S2/c1-9(16)12-4-11(7-20-12)5-13(17)15-3-2-10(6-15)8-21(14,18)19/h4,7,10H,2-3,5-6,8H2,1H3,(H2,14,18,19)/t10-/m1/s1 |
| InChIKey | FAYQPTMWKMNXAW-SNVBAGLBSA-N |
| XLogP | 0.63 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |