C20H23NO2S2 — CID 74243874
2-(5-acetylthiophen-3-yl)-1-[4-(4-methylphenyl)sulfanylpiperidin-1-yl]ethanone (PubChem CID 74243874) has the molecular formula C20H23NO2S2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 2-(5-acetylthiophen-3-yl)-1-[4-(4-methylphenyl)sulfanylpiperidin-1-yl]ethanone.
| Compound Name | 2-(5-acetylthiophen-3-yl)-1-[4-(4-methylphenyl)sulfanylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 74243874 |
| Molecular Formula | C20H23NO2S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-(5-acetylthiophen-3-yl)-1-[4-(4-methylphenyl)sulfanylpiperidin-1-yl]ethanone |
| SMILES | CC(=O)c1cc(CC(=O)N2CCC(Sc3ccc(C)cc3)CC2)cs1 |
| InChI | InChI=1S/C20H23NO2S2/c1-14-3-5-17(6-4-14)25-18-7-9-21(10-8-18)20(23)12-16-11-19(15(2)22)24-13-16/h3-6,11,13,18H,7-10,12H2,1-2H3 |
| InChIKey | SRBWWYHCBVETSW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |