C20H30N2O3 — CID 172657248
[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-propoxyphenyl)methanone (PubChem CID 172657248) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-propoxyphenyl)methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-propoxyphenyl)methanone |
|---|---|
| PubChem CID | 172657248 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-propoxyphenyl)methanone |
| SMILES | CCCOc1ccccc1C(=O)N1C[C@H]2C[C@@H](N(C)C)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C20H30N2O3/c1-4-9-25-19-8-6-5-7-16(19)20(24)22-12-14-10-17(21(2)3)18(23)11-15(14)13-22/h5-8,14-15,17-18,23H,4,9-13H2,1-3H3/t14-,15+,17-,18-/m1/s1 |
| InChIKey | CVTHNLZFFUWLEP-CYGHRXIMSA-N |
| XLogP | 2.25 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |