C27H36N2O4 — CID 4981271
[4-(2-butoxybenzoyl)-1,4-diazepan-1-yl]-(2-butoxyphenyl)methanone (PubChem CID 4981271) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is [4-(2-butoxybenzoyl)-1,4-diazepan-1-yl]-(2-butoxyphenyl)methanone.
| Compound Name | [4-(2-butoxybenzoyl)-1,4-diazepan-1-yl]-(2-butoxyphenyl)methanone |
|---|---|
| PubChem CID | 4981271 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | [4-(2-butoxybenzoyl)-1,4-diazepan-1-yl]-(2-butoxyphenyl)methanone |
| SMILES | CCCCOc1ccccc1C(=O)N1CCCN(C(=O)c2ccccc2OCCCC)CC1 |
| InChI | InChI=1S/C27H36N2O4/c1-3-5-20-32-24-14-9-7-12-22(24)26(30)28-16-11-17-29(19-18-28)27(31)23-13-8-10-15-25(23)33-21-6-4-2/h7-10,12-15H,3-6,11,16-21H2,1-2H3 |
| InChIKey | BXDMGNLJIKZRLR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|