C21H33N3O2 — CID 56747964
(2-butoxyphenyl)-(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)methanone (PubChem CID 56747964) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is (2-butoxyphenyl)-(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)methanone.
| Compound Name | (2-butoxyphenyl)-(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)methanone |
|---|---|
| PubChem CID | 56747964 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | (2-butoxyphenyl)-(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)methanone |
| SMILES | CCCCOc1ccccc1C(=O)N1CCC2(CC1)CN(C)CCN2C |
| InChI | InChI=1S/C21H33N3O2/c1-4-5-16-26-19-9-7-6-8-18(19)20(25)24-12-10-21(11-13-24)17-22(2)14-15-23(21)3/h6-9H,4-5,10-17H2,1-3H3 |
| InChIKey | GIZLMFRLMVKVCK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|