C19H26N2O3 — CID 95201542
(5R)-7-methyl-2-(2-propoxybenzoyl)-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 95201542) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (5R)-7-methyl-2-(2-propoxybenzoyl)-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5R)-7-methyl-2-(2-propoxybenzoyl)-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 95201542 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (5R)-7-methyl-2-(2-propoxybenzoyl)-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | CCCOc1ccccc1C(=O)N1CC[C@]2(CCCN(C)C2=O)C1 |
| InChI | InChI=1S/C19H26N2O3/c1-3-13-24-16-8-5-4-7-15(16)17(22)21-12-10-19(14-21)9-6-11-20(2)18(19)23/h4-5,7-8H,3,6,9-14H2,1-2H3/t19-/m1/s1 |
| InChIKey | GUEPFOHVJYBTNH-LJQANCHMSA-N |
| XLogP | 2.56 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |