C26H34N2O3 — CID 17199073
N-[4-(azepane-1-carbonyl)phenyl]-2-hexoxybenzamide (PubChem CID 17199073) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[4-(azepane-1-carbonyl)phenyl]-2-hexoxybenzamide.
| Compound Name | N-[4-(azepane-1-carbonyl)phenyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 17199073 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | N-[4-(azepane-1-carbonyl)phenyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccccc1C(=O)Nc1ccc(C(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C26H34N2O3/c1-2-3-4-11-20-31-24-13-8-7-12-23(24)25(29)27-22-16-14-21(15-17-22)26(30)28-18-9-5-6-10-19-28/h7-8,12-17H,2-6,9-11,18-20H2,1H3,(H,27,29) |
| InChIKey | ZMQSZVOMQLKSDC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|