C28H31N3O4 — CID 4942290
N-[4-[[(2-hexoxybenzoyl)amino]carbamoyl]phenyl]-2-methylbenzamide (PubChem CID 4942290) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is N-[4-[[(2-hexoxybenzoyl)amino]carbamoyl]phenyl]-2-methylbenzamide.
| Compound Name | N-[4-[[(2-hexoxybenzoyl)amino]carbamoyl]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 4942290 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | N-[4-[[(2-hexoxybenzoyl)amino]carbamoyl]phenyl]-2-methylbenzamide |
| SMILES | CCCCCCOc1ccccc1C(=O)NNC(=O)c1ccc(NC(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C28H31N3O4/c1-3-4-5-10-19-35-25-14-9-8-13-24(25)28(34)31-30-26(32)21-15-17-22(18-16-21)29-27(33)23-12-7-6-11-20(23)2/h6-9,11-18H,3-5,10,19H2,1-2H3,(H,29,33)(H,30,32)(H,31,34) |
| InChIKey | ZUZGIHHBYDEFFF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|