C20H23NO4 — CID 70729315
[3-(3-methoxyphenoxy)azetidin-1-yl]-(2-propoxyphenyl)methanone (PubChem CID 70729315) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is [3-(3-methoxyphenoxy)azetidin-1-yl]-(2-propoxyphenyl)methanone.
| Compound Name | [3-(3-methoxyphenoxy)azetidin-1-yl]-(2-propoxyphenyl)methanone |
|---|---|
| PubChem CID | 70729315 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [3-(3-methoxyphenoxy)azetidin-1-yl]-(2-propoxyphenyl)methanone |
| SMILES | CCCOc1ccccc1C(=O)N1CC(Oc2cccc(OC)c2)C1 |
| InChI | InChI=1S/C20H23NO4/c1-3-11-24-19-10-5-4-9-18(19)20(22)21-13-17(14-21)25-16-8-6-7-15(12-16)23-2/h4-10,12,17H,3,11,13-14H2,1-2H3 |
| InChIKey | NPSWAYZHIHHTBE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |