C20H23FN2O4 — CID 118792922
[2-(3-aminopropoxy)-5-methoxyphenyl]-[3-(2-fluorophenoxy)azetidin-1-yl]methanone (PubChem CID 118792922) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is [2-(3-aminopropoxy)-5-methoxyphenyl]-[3-(2-fluorophenoxy)azetidin-1-yl]methanone.
| Compound Name | [2-(3-aminopropoxy)-5-methoxyphenyl]-[3-(2-fluorophenoxy)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 118792922 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [2-(3-aminopropoxy)-5-methoxyphenyl]-[3-(2-fluorophenoxy)azetidin-1-yl]methanone |
| SMILES | COc1ccc(OCCCN)c(C(=O)N2CC(Oc3ccccc3F)C2)c1 |
| InChI | InChI=1S/C20H23FN2O4/c1-25-14-7-8-18(26-10-4-9-22)16(11-14)20(24)23-12-15(13-23)27-19-6-3-2-5-17(19)21/h2-3,5-8,11,15H,4,9-10,12-13,22H2,1H3 |
| InChIKey | SKPDFFSNKZEMHD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|