C18H25N5O3 — CID 118777830
[2-(3-aminopropoxy)-5-methoxyphenyl]-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]methanone (PubChem CID 118777830) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is [2-(3-aminopropoxy)-5-methoxyphenyl]-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]methanone.
| Compound Name | [2-(3-aminopropoxy)-5-methoxyphenyl]-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 118777830 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | [2-(3-aminopropoxy)-5-methoxyphenyl]-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]methanone |
| SMILES | COc1ccc(OCCCN)c(C(=O)N2CCC(n3cnnc3)CC2)c1 |
| InChI | InChI=1S/C18H25N5O3/c1-25-15-3-4-17(26-10-2-7-19)16(11-15)18(24)22-8-5-14(6-9-22)23-12-20-21-13-23/h3-4,11-14H,2,5-10,19H2,1H3 |
| InChIKey | DLFORBGDGRJZFV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|