C20H30FN3O2 — CID 118775958
[2-(3-aminopropoxy)-5-fluorophenyl]-(4-cyclohexylpiperazin-1-yl)methanone (PubChem CID 118775958) has the molecular formula C20H30FN3O2 and a molecular weight of 363.48 g/mol. Its IUPAC name is [2-(3-aminopropoxy)-5-fluorophenyl]-(4-cyclohexylpiperazin-1-yl)methanone.
| Compound Name | [2-(3-aminopropoxy)-5-fluorophenyl]-(4-cyclohexylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 118775958 |
| Molecular Formula | C20H30FN3O2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | [2-(3-aminopropoxy)-5-fluorophenyl]-(4-cyclohexylpiperazin-1-yl)methanone |
| SMILES | NCCCOc1ccc(F)cc1C(=O)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H30FN3O2/c21-16-7-8-19(26-14-4-9-22)18(15-16)20(25)24-12-10-23(11-13-24)17-5-2-1-3-6-17/h7-8,15,17H,1-6,9-14,22H2 |
| InChIKey | YMIRIRHJYWCWGL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|