C20H24FN3O2 — CID 126449120
[2-(3-aminopropoxy)-5-fluorophenyl]-[(2S)-2-pyridin-3-ylpiperidin-1-yl]methanone (PubChem CID 126449120) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is [2-(3-aminopropoxy)-5-fluorophenyl]-[(2S)-2-pyridin-3-ylpiperidin-1-yl]methanone.
| Compound Name | [2-(3-aminopropoxy)-5-fluorophenyl]-[(2S)-2-pyridin-3-ylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 126449120 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | [2-(3-aminopropoxy)-5-fluorophenyl]-[(2S)-2-pyridin-3-ylpiperidin-1-yl]methanone |
| SMILES | NCCCOc1ccc(F)cc1C(=O)N1CCCC[C@H]1c1cccnc1 |
| InChI | InChI=1S/C20H24FN3O2/c21-16-7-8-19(26-12-4-9-22)17(13-16)20(25)24-11-2-1-6-18(24)15-5-3-10-23-14-15/h3,5,7-8,10,13-14,18H,1-2,4,6,9,11-12,22H2/t18-/m0/s1 |
| InChIKey | VZVZHIZNMIUTDC-SFHVURJKSA-N |
| XLogP | 3.32 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|