C20H23FN2O3 — CID 118767196
[2-(3-aminopropoxy)-5-fluorophenyl]-[2-(3-methoxyphenyl)azetidin-1-yl]methanone (PubChem CID 118767196) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is [2-(3-aminopropoxy)-5-fluorophenyl]-[2-(3-methoxyphenyl)azetidin-1-yl]methanone.
| Compound Name | [2-(3-aminopropoxy)-5-fluorophenyl]-[2-(3-methoxyphenyl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 118767196 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | [2-(3-aminopropoxy)-5-fluorophenyl]-[2-(3-methoxyphenyl)azetidin-1-yl]methanone |
| SMILES | COc1cccc(C2CCN2C(=O)c2cc(F)ccc2OCCCN)c1 |
| InChI | InChI=1S/C20H23FN2O3/c1-25-16-5-2-4-14(12-16)18-8-10-23(18)20(24)17-13-15(21)6-7-19(17)26-11-3-9-22/h2,4-7,12-13,18H,3,8-11,22H2,1H3 |
| InChIKey | BOKICXOOKWOESV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|