C21H24F2N2O2 — CID 126444823
[2-(2-aminoethoxy)-5-fluorophenyl]-[(2S)-2-(3-fluorophenyl)azepan-1-yl]methanone (PubChem CID 126444823) has the molecular formula C21H24F2N2O2 and a molecular weight of 374.43 g/mol. Its IUPAC name is [2-(2-aminoethoxy)-5-fluorophenyl]-[(2S)-2-(3-fluorophenyl)azepan-1-yl]methanone.
| Compound Name | [2-(2-aminoethoxy)-5-fluorophenyl]-[(2S)-2-(3-fluorophenyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 126444823 |
| Molecular Formula | C21H24F2N2O2 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | [2-(2-aminoethoxy)-5-fluorophenyl]-[(2S)-2-(3-fluorophenyl)azepan-1-yl]methanone |
| SMILES | NCCOc1ccc(F)cc1C(=O)N1CCCCC[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C21H24F2N2O2/c22-16-6-4-5-15(13-16)19-7-2-1-3-11-25(19)21(26)18-14-17(23)8-9-20(18)27-12-10-24/h4-6,8-9,13-14,19H,1-3,7,10-12,24H2/t19-/m0/s1 |
| InChIKey | OBQRGOUUIGMHIT-IBGZPJMESA-N |
| XLogP | 4.06 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |