C12H15FN2O — CID 141445896
2-(3-fluorophenyl)piperidine-1-carboxamide (PubChem CID 141445896) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is 2-(3-fluorophenyl)piperidine-1-carboxamide.
| Compound Name | 2-(3-fluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 141445896 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2-(3-fluorophenyl)piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCCCC1c1cccc(F)c1 |
| InChI | InChI=1S/C12H15FN2O/c13-10-5-3-4-9(8-10)11-6-1-2-7-15(11)12(14)16/h3-5,8,11H,1-2,6-7H2,(H2,14,16) |
| InChIKey | DUNAUTQIJXDMCM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |