C17H14ClF2NO — CID 50747030
(2-chloro-6-fluorophenyl)-[2-(3-fluorophenyl)pyrrolidin-1-yl]methanone (PubChem CID 50747030) has the molecular formula C17H14ClF2NO and a molecular weight of 321.75 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-[2-(3-fluorophenyl)pyrrolidin-1-yl]methanone.
| Compound Name | (2-chloro-6-fluorophenyl)-[2-(3-fluorophenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 50747030 |
| Molecular Formula | C17H14ClF2NO |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-[2-(3-fluorophenyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1c(F)cccc1Cl)N1CCCC1c1cccc(F)c1 |
| InChI | InChI=1S/C17H14ClF2NO/c18-13-6-2-7-14(20)16(13)17(22)21-9-3-8-15(21)11-4-1-5-12(19)10-11/h1-2,4-7,10,15H,3,8-9H2 |
| InChIKey | MQCVCRYXPOCHCM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |