C19H21FN4O — CID 95278877
[(2S)-2-(3-fluorophenyl)pyrrolidin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone (PubChem CID 95278877) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is [(2S)-2-(3-fluorophenyl)pyrrolidin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone.
| Compound Name | [(2S)-2-(3-fluorophenyl)pyrrolidin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone |
|---|---|
| PubChem CID | 95278877 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | [(2S)-2-(3-fluorophenyl)pyrrolidin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone |
| SMILES | O=C(c1ccc(N2CCCC2)nn1)N1CCC[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C19H21FN4O/c20-15-6-3-5-14(13-15)17-7-4-12-24(17)19(25)16-8-9-18(22-21-16)23-10-1-2-11-23/h3,5-6,8-9,13,17H,1-2,4,7,10-12H2/t17-/m0/s1 |
| InChIKey | XUUJTHRWOHRQTM-KRWDZBQOSA-N |
| XLogP | 3.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |