C18H23FN4O — CID 131912952
2-(5-amino-3-methylpyrazol-1-yl)-1-[2-(3-fluorophenyl)azepan-1-yl]ethanone (PubChem CID 131912952) has the molecular formula C18H23FN4O and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-(5-amino-3-methylpyrazol-1-yl)-1-[2-(3-fluorophenyl)azepan-1-yl]ethanone.
| Compound Name | 2-(5-amino-3-methylpyrazol-1-yl)-1-[2-(3-fluorophenyl)azepan-1-yl]ethanone |
|---|---|
| PubChem CID | 131912952 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-(5-amino-3-methylpyrazol-1-yl)-1-[2-(3-fluorophenyl)azepan-1-yl]ethanone |
| SMILES | Cc1cc(N)n(CC(=O)N2CCCCCC2c2cccc(F)c2)n1 |
| InChI | InChI=1S/C18H23FN4O/c1-13-10-17(20)23(21-13)12-18(24)22-9-4-2-3-8-16(22)14-6-5-7-15(19)11-14/h5-7,10-11,16H,2-4,8-9,12,20H2,1H3 |
| InChIKey | XTULAXZRCBMWSQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |