C19H23FN4O2 — CID 97277231
5-(dimethylamino)-2-[2-[(2R)-2-(3-fluorophenyl)piperidin-1-yl]-2-oxoethyl]pyridazin-3-one (PubChem CID 97277231) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is 5-(dimethylamino)-2-[2-[(2R)-2-(3-fluorophenyl)piperidin-1-yl]-2-oxoethyl]pyridazin-3-one.
| Compound Name | 5-(dimethylamino)-2-[2-[(2R)-2-(3-fluorophenyl)piperidin-1-yl]-2-oxoethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 97277231 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 5-(dimethylamino)-2-[2-[(2R)-2-(3-fluorophenyl)piperidin-1-yl]-2-oxoethyl]pyridazin-3-one |
| SMILES | CN(C)c1cnn(CC(=O)N2CCCC[C@@H]2c2cccc(F)c2)c(=O)c1 |
| InChI | InChI=1S/C19H23FN4O2/c1-22(2)16-11-18(25)24(21-12-16)13-19(26)23-9-4-3-8-17(23)14-6-5-7-15(20)10-14/h5-7,10-12,17H,3-4,8-9,13H2,1-2H3/t17-/m1/s1 |
| InChIKey | NCBDSCGKWZRUAO-QGZVFWFLSA-N |
| XLogP | 2.20 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |