C17H22FN5O2 — CID 118785190
[2-(3-aminopropoxy)-5-fluorophenyl]-[2-(5-methyl-1H-1,2,4-triazol-3-yl)pyrrolidin-1-yl]methanone (PubChem CID 118785190) has the molecular formula C17H22FN5O2 and a molecular weight of 347.39 g/mol. Its IUPAC name is [2-(3-aminopropoxy)-5-fluorophenyl]-[2-(5-methyl-1H-1,2,4-triazol-3-yl)pyrrolidin-1-yl]methanone.
| Compound Name | [2-(3-aminopropoxy)-5-fluorophenyl]-[2-(5-methyl-1H-1,2,4-triazol-3-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 118785190 |
| Molecular Formula | C17H22FN5O2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | [2-(3-aminopropoxy)-5-fluorophenyl]-[2-(5-methyl-1H-1,2,4-triazol-3-yl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1nc(C2CCCN2C(=O)c2cc(F)ccc2OCCCN)n[nH]1 |
| InChI | InChI=1S/C17H22FN5O2/c1-11-20-16(22-21-11)14-4-2-8-23(14)17(24)13-10-12(18)5-6-15(13)25-9-3-7-19/h5-6,10,14H,2-4,7-9,19H2,1H3,(H,20,21,22) |
| InChIKey | HCMWUIBBSZKHKB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|