C16H22N4O4 — CID 118770151
2-[2-(3-aminopropoxy)-5-methoxybenzoyl]-2,5,7-triazaspiro[3.4]octan-6-one (PubChem CID 118770151) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[2-(3-aminopropoxy)-5-methoxybenzoyl]-2,5,7-triazaspiro[3.4]octan-6-one.
| Compound Name | 2-[2-(3-aminopropoxy)-5-methoxybenzoyl]-2,5,7-triazaspiro[3.4]octan-6-one |
|---|---|
| PubChem CID | 118770151 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-[2-(3-aminopropoxy)-5-methoxybenzoyl]-2,5,7-triazaspiro[3.4]octan-6-one |
| SMILES | COc1ccc(OCCCN)c(C(=O)N2CC3(CNC(=O)N3)C2)c1 |
| InChI | InChI=1S/C16H22N4O4/c1-23-11-3-4-13(24-6-2-5-17)12(7-11)14(21)20-9-16(10-20)8-18-15(22)19-16/h3-4,7H,2,5-6,8-10,17H2,1H3,(H2,18,19,22) |
| InChIKey | YBJACPPAVCNGRR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|