C24H24N6O2 — CID 172658925
[(3aS,5R,6R,7aR)-5-(benzimidazol-1-yl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone (PubChem CID 172658925) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(benzimidazol-1-yl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-(benzimidazol-1-yl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 172658925 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(benzimidazol-1-yl)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1ccccc1-n1cncn1)N1C[C@H]2C[C@@H](n3cnc4ccccc43)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C24H24N6O2/c31-23-10-17-12-28(24(32)18-5-1-3-7-20(18)30-14-25-13-27-30)11-16(17)9-22(23)29-15-26-19-6-2-4-8-21(19)29/h1-8,13-17,22-23,31H,9-12H2/t16-,17+,22-,23-/m1/s1 |
| InChIKey | VAGJOWWSVZBWIL-OIDISNMWSA-N |
| XLogP | 2.70 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |