C22H25NO5 — CID 167778718
[(4aR,6S,7aS)-6-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(2-hydroxy-5-phenylmethoxyphenyl)methanone (PubChem CID 167778718) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is [(4aR,6S,7aS)-6-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(2-hydroxy-5-phenylmethoxyphenyl)methanone.
| Compound Name | [(4aR,6S,7aS)-6-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(2-hydroxy-5-phenylmethoxyphenyl)methanone |
|---|---|
| PubChem CID | 167778718 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [(4aR,6S,7aS)-6-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(2-hydroxy-5-phenylmethoxyphenyl)methanone |
| SMILES | CO[C@@H]1C[C@@H]2OCCN(C(=O)c3cc(OCc4ccccc4)ccc3O)[C@@H]2C1 |
| InChI | InChI=1S/C22H25NO5/c1-26-17-12-19-21(13-17)27-10-9-23(19)22(25)18-11-16(7-8-20(18)24)28-14-15-5-3-2-4-6-15/h2-8,11,17,19,21,24H,9-10,12-14H2,1H3/t17-,19+,21-/m0/s1 |
| InChIKey | XWCDXMJOGPFSBT-DSKINZAPSA-N |
| XLogP | 2.99 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |