C18H25NO3 — CID 97242562
1-[(4aS,6R,8aR)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(3-methylphenyl)ethanone (PubChem CID 97242562) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 1-[(4aS,6R,8aR)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(3-methylphenyl)ethanone.
| Compound Name | 1-[(4aS,6R,8aR)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 97242562 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1-[(4aS,6R,8aR)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-(3-methylphenyl)ethanone |
| SMILES | CO[C@@H]1CC[C@H]2OCCN(C(=O)Cc3cccc(C)c3)[C@H]2C1 |
| InChI | InChI=1S/C18H25NO3/c1-13-4-3-5-14(10-13)11-18(20)19-8-9-22-17-7-6-15(21-2)12-16(17)19/h3-5,10,15-17H,6-9,11-12H2,1-2H3/t15-,16+,17-/m1/s1 |
| InChIKey | GYLDSTDDNJOCBZ-IXDOHACOSA-N |
| XLogP | 2.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |