C18H22N2O3 — CID 124776837
[(4aS,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(1H-indol-7-yl)methanone (PubChem CID 124776837) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is [(4aS,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(1H-indol-7-yl)methanone.
| Compound Name | [(4aS,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(1H-indol-7-yl)methanone |
|---|---|
| PubChem CID | 124776837 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [(4aS,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(1H-indol-7-yl)methanone |
| SMILES | CO[C@@H]1CC[C@@H]2OCCN(C(=O)c3cccc4cc[nH]c34)[C@H]2C1 |
| InChI | InChI=1S/C18H22N2O3/c1-22-13-5-6-16-15(11-13)20(9-10-23-16)18(21)14-4-2-3-12-7-8-19-17(12)14/h2-4,7-8,13,15-16,19H,5-6,9-11H2,1H3/t13-,15+,16+/m1/s1 |
| InChIKey | BTAXXGXBEOMERK-KBMXLJTQSA-N |
| XLogP | 2.58 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |