C17H21N3O3 — CID 97243375
[(4aR,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(3H-benzimidazol-5-yl)methanone (PubChem CID 97243375) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is [(4aR,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(3H-benzimidazol-5-yl)methanone.
| Compound Name | [(4aR,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(3H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 97243375 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | [(4aR,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(3H-benzimidazol-5-yl)methanone |
| SMILES | CO[C@@H]1CC[C@@H]2OCCN(C(=O)c3ccc4nc[nH]c4c3)[C@@H]2C1 |
| InChI | InChI=1S/C17H21N3O3/c1-22-12-3-5-16-15(9-12)20(6-7-23-16)17(21)11-2-4-13-14(8-11)19-10-18-13/h2,4,8,10,12,15-16H,3,5-7,9H2,1H3,(H,18,19)/t12-,15-,16+/m1/s1 |
| InChIKey | OWCNZUHGRYGYSX-WQVCFCJDSA-N |
| XLogP | 1.97 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |