C16H17F4NO3 — CID 124840951
[(4aS,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(2,3,5,6-tetrafluorophenyl)methanone (PubChem CID 124840951) has the molecular formula C16H17F4NO3 and a molecular weight of 347.31 g/mol. Its IUPAC name is [(4aS,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(2,3,5,6-tetrafluorophenyl)methanone.
| Compound Name | [(4aS,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(2,3,5,6-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 124840951 |
| Molecular Formula | C16H17F4NO3 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | [(4aS,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-(2,3,5,6-tetrafluorophenyl)methanone |
| SMILES | CO[C@@H]1CC[C@@H]2OCCN(C(=O)c3c(F)c(F)cc(F)c3F)[C@H]2C1 |
| InChI | InChI=1S/C16H17F4NO3/c1-23-8-2-3-12-11(6-8)21(4-5-24-12)16(22)13-14(19)9(17)7-10(18)15(13)20/h7-8,11-12H,2-6H2,1H3/t8-,11+,12+/m1/s1 |
| InChIKey | RORJGJLKTWGPKT-ZHAHWJHGSA-N |
| XLogP | 2.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|