C17H24N2O3 — CID 99852708
(2S)-1-[(4aR,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-amino-2-phenylethanone (PubChem CID 99852708) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is (2S)-1-[(4aR,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-amino-2-phenylethanone.
| Compound Name | (2S)-1-[(4aR,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-amino-2-phenylethanone |
|---|---|
| PubChem CID | 99852708 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (2S)-1-[(4aR,6R,8aS)-6-methoxy-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-amino-2-phenylethanone |
| SMILES | CO[C@@H]1CC[C@@H]2OCCN(C(=O)[C@@H](N)c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C17H24N2O3/c1-21-13-7-8-15-14(11-13)19(9-10-22-15)17(20)16(18)12-5-3-2-4-6-12/h2-6,13-16H,7-11,18H2,1H3/t13-,14-,15+,16+/m1/s1 |
| InChIKey | DYHYNHMNIUWZFW-WCVJEAGWSA-N |
| XLogP | 1.48 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |