C16H21FN2O3 — CID 129485599
[(4aR,8aS)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(2-fluoro-6-methoxyphenyl)methanone (PubChem CID 129485599) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is [(4aR,8aS)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(2-fluoro-6-methoxyphenyl)methanone.
| Compound Name | [(4aR,8aS)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(2-fluoro-6-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 129485599 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | [(4aR,8aS)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]-(2-fluoro-6-methoxyphenyl)methanone |
| SMILES | COc1cccc(F)c1C(=O)N1CCO[C@H]2CCN(C)C[C@H]21 |
| InChI | InChI=1S/C16H21FN2O3/c1-18-7-6-13-12(10-18)19(8-9-22-13)16(20)15-11(17)4-3-5-14(15)21-2/h3-5,12-13H,6-10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | ZYQWZGKKRVMQCA-OLZOCXBDSA-N |
| XLogP | 1.38 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |