C12H23ClN2 — CID 77010212
N-[[1-(3-chloroprop-2-enyl)piperidin-2-yl]methyl]propan-2-amine (PubChem CID 77010212) has the molecular formula C12H23ClN2 and a molecular weight of 230.78 g/mol. Its IUPAC name is N-[[1-(3-chloroprop-2-enyl)piperidin-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-(3-chloroprop-2-enyl)piperidin-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 77010212 |
| Molecular Formula | C12H23ClN2 |
| Molecular Weight | 230.78 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-[[1-(3-chloroprop-2-enyl)piperidin-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1CCCCN1CC=CCl |
| InChI | InChI=1S/C12H23ClN2/c1-11(2)14-10-12-6-3-4-8-15(12)9-5-7-13/h5,7,11-12,14H,3-4,6,8-10H2,1-2H3 |
| InChIKey | CJTKEQYYSKRQDH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.78 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |