C8H20N2O — CID 142979324
ethane;(2S)-1-hydroxy-2,4-dimethylpiperazine (PubChem CID 142979324) has the molecular formula C8H20N2O and a molecular weight of 160.26 g/mol. Its IUPAC name is ethane;(2S)-1-hydroxy-2,4-dimethylpiperazine.
| Compound Name | ethane;(2S)-1-hydroxy-2,4-dimethylpiperazine |
|---|---|
| PubChem CID | 142979324 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | ethane;(2S)-1-hydroxy-2,4-dimethylpiperazine |
| SMILES | CC.C[C@H]1CN(C)CCN1O |
| InChI | InChI=1S/C6H14N2O.C2H6/c1-6-5-7(2)3-4-8(6)9;1-2/h6,9H,3-5H2,1-2H3;1-2H3/t6-;/m0./s1 |
| InChIKey | ZBEKTGIMQZWMAA-RGMNGODLSA-N |
| XLogP | 1.04 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |