C10H23N3O — CID 144801941
ethane;N,2,4-trimethylpiperazine-1-carboxamide (PubChem CID 144801941) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is ethane;N,2,4-trimethylpiperazine-1-carboxamide.
| Compound Name | ethane;N,2,4-trimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 144801941 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | ethane;N,2,4-trimethylpiperazine-1-carboxamide |
| SMILES | CC.CNC(=O)N1CCN(C)CC1C |
| InChI | InChI=1S/C8H17N3O.C2H6/c1-7-6-10(3)4-5-11(7)8(12)9-2;1-2/h7H,4-6H2,1-3H3,(H,9,12);1-2H3 |
| InChIKey | ARGZKZGAKAREBR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |