C6H14N2O2 — CID 175346878
(2S,5S)-1,4-dihydroxy-2,5-dimethylpiperazine (PubChem CID 175346878) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is (2S,5S)-1,4-dihydroxy-2,5-dimethylpiperazine.
| Compound Name | (2S,5S)-1,4-dihydroxy-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 175346878 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (2S,5S)-1,4-dihydroxy-2,5-dimethylpiperazine |
| SMILES | C[C@H]1CN(O)[C@@H](C)CN1O |
| InChI | InChI=1S/C6H14N2O2/c1-5-3-8(10)6(2)4-7(5)9/h5-6,9-10H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | KEDZZADHAFJLJF-WDSKDSINSA-N |
| XLogP | 0.16 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |