C6H12Cl2N2 — CID 129411829
(2R,5S)-1,4-dichloro-2,5-dimethylpiperazine (PubChem CID 129411829) has the molecular formula C6H12Cl2N2 and a molecular weight of 183.08 g/mol. Its IUPAC name is (2R,5S)-1,4-dichloro-2,5-dimethylpiperazine.
| Compound Name | (2R,5S)-1,4-dichloro-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 129411829 |
| Molecular Formula | C6H12Cl2N2 |
| Molecular Weight | 183.08 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | (2R,5S)-1,4-dichloro-2,5-dimethylpiperazine |
| SMILES | C[C@@H]1CN(Cl)[C@@H](C)CN1Cl |
| InChI | InChI=1S/C6H12Cl2N2/c1-5-3-10(8)6(2)4-9(5)7/h5-6H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | IVRLPPGKJJZQJZ-OLQVQODUSA-N |
| XLogP | 1.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.08 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|