C6H12N2-2 — CID 168813699
(2R,5S)-2,5-dimethylpiperazine-1,4-diide (PubChem CID 168813699) has the molecular formula C6H12N2-2 and a molecular weight of 112.18 g/mol. Its IUPAC name is (2R,5S)-2,5-dimethylpiperazine-1,4-diide.
| Compound Name | (2R,5S)-2,5-dimethylpiperazine-1,4-diide |
|---|---|
| PubChem CID | 168813699 |
| Molecular Formula | C6H12N2-2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (2R,5S)-2,5-dimethylpiperazine-1,4-diide |
| SMILES | C[C@@H]1C[N-][C@@H](C)C[N-]1 |
| InChI | InChI=1S/C6H12N2/c1-5-3-8-6(2)4-7-5/h5-6H,3-4H2,1-2H3/q-2/t5-,6+ |
| InChIKey | XNERPCPSYCNUDF-OLQVQODUSA-N |
| XLogP | 1.52 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |