C7H15N2- — CID 142097716
1,3,5-trimethylpiperazin-4-ide (PubChem CID 142097716) has the molecular formula C7H15N2- and a molecular weight of 127.21 g/mol. Its IUPAC name is 1,3,5-trimethylpiperazin-4-ide.
| Compound Name | 1,3,5-trimethylpiperazin-4-ide |
|---|---|
| PubChem CID | 142097716 |
| Molecular Formula | C7H15N2- |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.12 |
| IUPAC Name | 1,3,5-trimethylpiperazin-4-ide |
| SMILES | CC1CN(C)CC(C)[N-]1 |
| InChI | InChI=1S/C7H15N2/c1-6-4-9(3)5-7(2)8-6/h6-7H,4-5H2,1-3H3/q-1 |
| InChIKey | OCKKIVHCAPFVEB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |