C5H10Cl2N2 — CID 45099488
1,4-dichloro-2-methylpiperazine (PubChem CID 45099488) has the molecular formula C5H10Cl2N2 and a molecular weight of 169.05 g/mol. Its IUPAC name is 1,4-dichloro-2-methylpiperazine.
| Compound Name | 1,4-dichloro-2-methylpiperazine |
|---|---|
| PubChem CID | 45099488 |
| Molecular Formula | C5H10Cl2N2 |
| Molecular Weight | 169.05 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 1,4-dichloro-2-methylpiperazine |
| SMILES | CC1CN(Cl)CCN1Cl |
| InChI | InChI=1S/C5H10Cl2N2/c1-5-4-8(6)2-3-9(5)7/h5H,2-4H2,1H3 |
| InChIKey | SWDJPBGAZBDTCR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.05 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|