C7H15N2- — CID 88553482
(2S)-4-methanidyl-1,2-dimethylpiperazine (PubChem CID 88553482) has the molecular formula C7H15N2- and a molecular weight of 127.21 g/mol. Its IUPAC name is (2S)-4-methanidyl-1,2-dimethylpiperazine.
| Compound Name | (2S)-4-methanidyl-1,2-dimethylpiperazine |
|---|---|
| PubChem CID | 88553482 |
| Molecular Formula | C7H15N2- |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.12 |
| IUPAC Name | (2S)-4-methanidyl-1,2-dimethylpiperazine |
| SMILES | [CH2-]N1CCN(C)[C@@H](C)C1 |
| InChI | InChI=1S/C7H15N2/c1-7-6-8(2)4-5-9(7)3/h7H,2,4-6H2,1,3H3/q-1/t7-/m0/s1 |
| InChIKey | ONZJLZCBVGJILL-ZETCQYMHSA-N |
| XLogP | 0.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|